C20H22N2O4 — CID 113077448
1,3-benzodioxol-5-yl-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 113077448) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 113077448 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(4-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(N2CCN(C(=O)c3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-24-17-6-4-16(5-7-17)21-9-11-22(12-10-21)20(23)15-3-8-18-19(13-15)26-14-25-18/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | GQAFBJOVTNJZIG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|