C20H22N2O3 — CID 113079614
[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-(3,4-dimethylphenyl)methanone (PubChem CID 113079614) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-(3,4-dimethylphenyl)methanone.
| Compound Name | [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 113079614 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc4c(c3)OCO4)CC2)cc1C |
| InChI | InChI=1S/C20H22N2O3/c1-14-3-4-16(11-15(14)2)20(23)22-9-7-21(8-10-22)17-5-6-18-19(12-17)25-13-24-18/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | YSZYHDWUFDCOSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|