C19H19ClN2O3 — CID 110363916
(4-chlorophenyl)-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]methanone (PubChem CID 110363916) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110363916 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (4-chlorophenyl)-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-15-3-1-14(2-4-15)19(23)22-9-7-21(8-10-22)16-5-6-17-18(13-16)25-12-11-24-17/h1-6,13H,7-12H2 |
| InChIKey | DBRQMSSOGCLUGI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|