C17H24N2O3 — CID 110363875
1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 110363875) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110363875 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-13(2)11-17(20)19-7-5-18(6-8-19)14-3-4-15-16(12-14)22-10-9-21-15/h3-4,12-13H,5-11H2,1-2H3 |
| InChIKey | XGXLECUCOVIKRZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|