C16H23N3O3 — CID 113104385
4-(1,3-benzodioxol-5-yl)-N-butan-2-ylpiperazine-1-carboxamide (PubChem CID 113104385) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-butan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-butan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 113104385 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-butan-2-ylpiperazine-1-carboxamide |
| SMILES | CCC(C)NC(=O)N1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-12(2)17-16(20)19-8-6-18(7-9-19)13-4-5-14-15(10-13)22-11-21-14/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,17,20) |
| InChIKey | FOOSXGRUILICBO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|