C17H25N3O3 — CID 110363934
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 110363934) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110363934 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-18(4-2)17(21)20-9-7-19(8-10-20)14-5-6-15-16(13-14)23-12-11-22-15/h5-6,13H,3-4,7-12H2,1-2H3 |
| InChIKey | MSDFQBNMKWOCCY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|