C22H27N3O3 — CID 113112475
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide (PubChem CID 113112475) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112475 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)N2CCN(c3ccc4c(c3)OCCO4)CC2)c(C)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-15-12-16(2)21(17(3)13-15)23-22(26)25-8-6-24(7-9-25)18-4-5-19-20(14-18)28-11-10-27-19/h4-5,12-14H,6-11H2,1-3H3,(H,23,26) |
| InChIKey | HKYPZENMUHUHEY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|