C15H17N2O5- — CID 2051756
3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-oxopropanoate (PubChem CID 2051756) has the molecular formula C15H17N2O5- and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-oxopropanoate.
| Compound Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 2051756 |
| Molecular Formula | C15H17N2O5- |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-3-oxopropanoate |
| SMILES | O=C([O-])CC(=O)N1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C15H18N2O5/c18-14(10-15(19)20)17-5-3-16(4-6-17)11-1-2-12-13(9-11)22-8-7-21-12/h1-2,9H,3-8,10H2,(H,19,20)/p-1 |
| InChIKey | GUKKTJVUHMOWLA-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|