C17H18N4O5 — CID 108557370
N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 108557370) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108557370 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1)c1cnccn1 |
| InChI | InChI=1S/C17H18N4O5/c22-13-7-10(8-14(23)15(13)24)17(26)21-5-1-11(2-6-21)20-16(25)12-9-18-3-4-19-12/h3-4,7-9,11,22-24H,1-2,5-6H2,(H,20,25) |
| InChIKey | FLLGGDMSHOAQIN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|