C14H19ClN4O2 — CID 108562614
N-[1-(4-chlorobutanoyl)piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 108562614) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is N-[1-(4-chlorobutanoyl)piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(4-chlorobutanoyl)piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108562614 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[1-(4-chlorobutanoyl)piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)CCCCl)CC1)c1cnccn1 |
| InChI | InChI=1S/C14H19ClN4O2/c15-5-1-2-13(20)19-8-3-11(4-9-19)18-14(21)12-10-16-6-7-17-12/h6-7,10-11H,1-5,8-9H2,(H,18,21) |
| InChIKey | ZXWMGXSOEWEORB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|