C15H22N4O3 — CID 108562616
2-methylpropyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate (PubChem CID 108562616) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-methylpropyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108562616 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-methylpropyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(NC(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-11(2)10-22-15(21)19-7-3-12(4-8-19)18-14(20)13-9-16-5-6-17-13/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H,18,20) |
| InChIKey | GOIPFKILWXOFSK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |