C12H16N4O3 — CID 110821817
methyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate (PubChem CID 110821817) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate.
| Compound Name | methyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110821817 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl 4-(pyrazine-2-carbonylamino)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C12H16N4O3/c1-19-12(18)16-6-2-9(3-7-16)15-11(17)10-8-13-4-5-14-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,15,17) |
| InChIKey | AYDNAUBHPMINQU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |