C11H16N4O — CID 110471343
N-(1-methylpiperidin-3-yl)pyrazine-2-carboxamide (PubChem CID 110471343) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-(1-methylpiperidin-3-yl)pyrazine-2-carboxamide.
| Compound Name | N-(1-methylpiperidin-3-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110471343 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-(1-methylpiperidin-3-yl)pyrazine-2-carboxamide |
| SMILES | CN1CCCC(NC(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C11H16N4O/c1-15-6-2-3-9(8-15)14-11(16)10-7-12-4-5-13-10/h4-5,7,9H,2-3,6,8H2,1H3,(H,14,16) |
| InChIKey | CDXJGQSSFSPCEF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |