C16H20ClFN2O2 — CID 108562648
N-[1-(4-chlorobutanoyl)piperidin-4-yl]-3-fluorobenzamide (PubChem CID 108562648) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is N-[1-(4-chlorobutanoyl)piperidin-4-yl]-3-fluorobenzamide.
| Compound Name | N-[1-(4-chlorobutanoyl)piperidin-4-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 108562648 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[1-(4-chlorobutanoyl)piperidin-4-yl]-3-fluorobenzamide |
| SMILES | O=C(NC1CCN(C(=O)CCCCl)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H20ClFN2O2/c17-8-2-5-15(21)20-9-6-14(7-10-20)19-16(22)12-3-1-4-13(18)11-12/h1,3-4,11,14H,2,5-10H2,(H,19,22) |
| InChIKey | HYWFXIRHROXYNF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|