C14H14F4N2O2 — CID 108557444
3-fluoro-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]benzamide (PubChem CID 108557444) has the molecular formula C14H14F4N2O2 and a molecular weight of 318.27 g/mol. Its IUPAC name is 3-fluoro-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]benzamide.
| Compound Name | 3-fluoro-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108557444 |
| Molecular Formula | C14H14F4N2O2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-fluoro-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)C(F)(F)F)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H14F4N2O2/c15-10-3-1-2-9(8-10)12(21)19-11-4-6-20(7-5-11)13(22)14(16,17)18/h1-3,8,11H,4-7H2,(H,19,21) |
| InChIKey | CUQYLZTYLOSMKB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |