C13H10N4O4 — CID 17388270
N'-(1,3-benzodioxole-5-carbonyl)pyrazine-2-carbohydrazide (PubChem CID 17388270) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)pyrazine-2-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 17388270 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)pyrazine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cnccn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H10N4O4/c18-12(8-1-2-10-11(5-8)21-7-20-10)16-17-13(19)9-6-14-3-4-15-9/h1-6H,7H2,(H,16,18)(H,17,19) |
| InChIKey | BRSGYEPNBRXIHK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|