C18H14N4O4 — CID 17473757
N'-(1,3-benzodioxole-5-carbonyl)-3-phenylimidazole-4-carbohydrazide (PubChem CID 17473757) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-3-phenylimidazole-4-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-3-phenylimidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 17473757 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-3-phenylimidazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cncn1-c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N4O4/c23-17(12-6-7-15-16(8-12)26-11-25-15)20-21-18(24)14-9-19-10-22(14)13-4-2-1-3-5-13/h1-10H,11H2,(H,20,23)(H,21,24) |
| InChIKey | DFLAECSHBJSRCH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|