C15H17N5O2 — CID 71898793
1-(cyclopropylmethyl)-3-[(3-phenylimidazole-4-carbonyl)amino]urea (PubChem CID 71898793) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[(3-phenylimidazole-4-carbonyl)amino]urea.
| Compound Name | 1-(cyclopropylmethyl)-3-[(3-phenylimidazole-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 71898793 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[(3-phenylimidazole-4-carbonyl)amino]urea |
| SMILES | O=C(NCC1CC1)NNC(=O)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C15H17N5O2/c21-14(18-19-15(22)17-8-11-6-7-11)13-9-16-10-20(13)12-4-2-1-3-5-12/h1-5,9-11H,6-8H2,(H,18,21)(H2,17,19,22) |
| InChIKey | HLZYVWMKUOFRHC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|