C24H24N4O4 — CID 55773047
N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide (PubChem CID 55773047) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55773047 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)c2c1CCCCC2)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H24N4O4/c29-23(16-11-12-20-21(15-16)32-14-13-31-20)25-26-24(30)22-18-9-5-2-6-10-19(18)28(27-22)17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15H,2,5-6,9-10,13-14H2,(H,25,29)(H,26,30) |
| InChIKey | QFDKTTHMUOTHCU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|