C20H17FN4O2 — CID 17421166
N'-(2-fluorobenzoyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide (PubChem CID 17421166) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is N'-(2-fluorobenzoyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-(2-fluorobenzoyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17421166 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N'-(2-fluorobenzoyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)c2c1CCC2)c1ccccc1F |
| InChI | InChI=1S/C20H17FN4O2/c21-16-11-5-4-9-14(16)19(26)22-23-20(27)18-15-10-6-12-17(15)25(24-18)13-7-2-1-3-8-13/h1-5,7-9,11H,6,10,12H2,(H,22,26)(H,23,27) |
| InChIKey | FOJZPHUHWYDBNI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|