C19H18N4O3 — CID 46680465
N'-(2-methylfuran-3-carbonyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide (PubChem CID 46680465) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N'-(2-methylfuran-3-carbonyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-(2-methylfuran-3-carbonyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46680465 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N'-(2-methylfuran-3-carbonyl)-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1nn(-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C19H18N4O3/c1-12-14(10-11-26-12)18(24)20-21-19(25)17-15-8-5-9-16(15)23(22-17)13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | SEVJRPGZDOUKFH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|