C24H24ClFN4O2 — CID 55975088
1-(4-chlorophenyl)-N-[2-[(2-fluorobenzoyl)amino]ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide (PubChem CID 55975088) has the molecular formula C24H24ClFN4O2 and a molecular weight of 454.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[(2-fluorobenzoyl)amino]ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[(2-fluorobenzoyl)amino]ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55975088 |
| Molecular Formula | C24H24ClFN4O2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[(2-fluorobenzoyl)amino]ethyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nn(-c2ccc(Cl)cc2)c2c1CCCCC2)c1ccccc1F |
| InChI | InChI=1S/C24H24ClFN4O2/c25-16-10-12-17(13-11-16)30-21-9-3-1-2-7-19(21)22(29-30)24(32)28-15-14-27-23(31)18-6-4-5-8-20(18)26/h4-6,8,10-13H,1-3,7,9,14-15H2,(H,27,31)(H,28,32) |
| InChIKey | LTJCZJQOXIYHCS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|