About [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 7985579) has the molecular formula C14H10N2O5
and a molecular weight of 286.24 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate.
Analyze [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate (CID 7985579) is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate is O=C(COC(=O)c1cnccn1)c1ccc2c(c1)OCO2.
What is the InChIKey of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is ZPRGVIOHQAYAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O5/c17-11(7-19-14(18)10-6-15-3-4-16-10)9-1-2-12-13(5-9)21-8-20-12/h1-6H,7-8H2.
What are the key properties of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate?
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 286.24 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 7985579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).