C21H21FN2O — CID 113088033
(3-fluorophenyl)-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone (PubChem CID 113088033) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113088033 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3-fluorophenyl)-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc2[nH]c(C3CCN(C(=O)c4cccc(F)c4)CC3)cc2c1 |
| InChI | InChI=1S/C21H21FN2O/c1-14-5-6-19-17(11-14)13-20(23-19)15-7-9-24(10-8-15)21(25)16-3-2-4-18(22)12-16/h2-6,11-13,15,23H,7-10H2,1H3 |
| InChIKey | ZTIUOCSGIXFMSI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |