C19H18FN5O2S — CID 124958092
4-[(3R)-1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]-N-pyridin-2-ylpyrimidin-2-amine (PubChem CID 124958092) has the molecular formula C19H18FN5O2S and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[(3R)-1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]-N-pyridin-2-ylpyrimidin-2-amine.
| Compound Name | 4-[(3R)-1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]-N-pyridin-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 124958092 |
| Molecular Formula | C19H18FN5O2S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-[(3R)-1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]-N-pyridin-2-ylpyrimidin-2-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CC[C@@H](c2ccnc(Nc3ccccn3)n2)C1 |
| InChI | InChI=1S/C19H18FN5O2S/c20-15-4-6-16(7-5-15)28(26,27)25-12-9-14(13-25)17-8-11-22-19(23-17)24-18-3-1-2-10-21-18/h1-8,10-11,14H,9,12-13H2,(H,21,22,23,24)/t14-/m1/s1 |
| InChIKey | GDSCTPWTTVNFPR-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |