C21H23FN4O2S — CID 95839090
2-(2-ethylimidazol-1-yl)-6-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]pyridine (PubChem CID 95839090) has the molecular formula C21H23FN4O2S and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(2-ethylimidazol-1-yl)-6-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]pyridine.
| Compound Name | 2-(2-ethylimidazol-1-yl)-6-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95839090 |
| Molecular Formula | C21H23FN4O2S |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-(2-ethylimidazol-1-yl)-6-[(3S)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]pyridine |
| SMILES | CCc1nccn1-c1cccc([C@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C21H23FN4O2S/c1-2-20-23-12-14-26(20)21-7-3-6-19(24-21)16-5-4-13-25(15-16)29(27,28)18-10-8-17(22)9-11-18/h3,6-12,14,16H,2,4-5,13,15H2,1H3/t16-/m0/s1 |
| InChIKey | IZRLHTSCDHOHAL-INIZCTEOSA-N |
| XLogP | 3.54 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |