C14H18N4O2S2 — CID 27518341
3-[(3S)-1-(benzenesulfonyl)piperidin-3-yl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 27518341) has the molecular formula C14H18N4O2S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 3-[(3S)-1-(benzenesulfonyl)piperidin-3-yl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(3S)-1-(benzenesulfonyl)piperidin-3-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 27518341 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[(3S)-1-(benzenesulfonyl)piperidin-3-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c([C@H]2CCCN(S(=O)(=O)c3ccccc3)C2)n[nH]c1=S |
| InChI | InChI=1S/C14H18N4O2S2/c1-17-13(15-16-14(17)21)11-6-5-9-18(10-11)22(19,20)12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10H2,1H3,(H,16,21)/t11-/m0/s1 |
| InChIKey | VFDDUFSKYCCDEI-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|