C24H26N6O2S2 — CID 17023561
3-[1-(benzenesulfonyl)piperidin-3-yl]-4-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 17023561) has the molecular formula C24H26N6O2S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)piperidin-3-yl]-4-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-(benzenesulfonyl)piperidin-3-yl]-4-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17023561 |
| Molecular Formula | C24H26N6O2S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-[1-(benzenesulfonyl)piperidin-3-yl]-4-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(Cn2cc(-n3c(C4CCCN(S(=O)(=O)c5ccccc5)C4)n[nH]c3=S)cn2)cc1 |
| InChI | InChI=1S/C24H26N6O2S2/c1-18-9-11-19(12-10-18)15-28-17-21(14-25-28)30-23(26-27-24(30)33)20-6-5-13-29(16-20)34(31,32)22-7-3-2-4-8-22/h2-4,7-12,14,17,20H,5-6,13,15-16H2,1H3,(H,27,33) |
| InChIKey | YIHKMSRAVYRZFS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|