C18H21ClN6O2S2 — CID 4777273
4-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-(1-methylsulfonylpiperidin-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 4777273) has the molecular formula C18H21ClN6O2S2 and a molecular weight of 452.99 g/mol. Its IUPAC name is 4-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-(1-methylsulfonylpiperidin-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-(1-methylsulfonylpiperidin-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4777273 |
| Molecular Formula | C18H21ClN6O2S2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-3-(1-methylsulfonylpiperidin-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CS(=O)(=O)N1CCCC(c2n[nH]c(=S)n2-c2cnn(Cc3ccccc3Cl)c2)C1 |
| InChI | InChI=1S/C18H21ClN6O2S2/c1-29(26,27)24-8-4-6-14(11-24)17-21-22-18(28)25(17)15-9-20-23(12-15)10-13-5-2-3-7-16(13)19/h2-3,5,7,9,12,14H,4,6,8,10-11H2,1H3,(H,22,28) |
| InChIKey | BIHVFYQRNSBHPZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|