C19H22ClN3O3 — CID 42924083
ethyl 1-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperidine-3-carboxylate (PubChem CID 42924083) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is ethyl 1-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42924083 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | ethyl 1-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cnn(Cc3ccccc3Cl)c2)C1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-2-26-19(25)15-7-5-9-22(11-15)18(24)16-10-21-23(13-16)12-14-6-3-4-8-17(14)20/h3-4,6,8,10,13,15H,2,5,7,9,11-12H2,1H3 |
| InChIKey | YWRHQQMQNFDRLU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |