C22H22ClN3O — CID 55552266
[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-[2-(4-methylphenyl)pyrrolidin-1-yl]methanone (PubChem CID 55552266) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-[2-(4-methylphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-[2-(4-methylphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 55552266 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]pyrazol-4-yl]-[2-(4-methylphenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc(C2CCCN2C(=O)c2cnn(Cc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C22H22ClN3O/c1-16-8-10-17(11-9-16)21-7-4-12-26(21)22(27)19-13-24-25(15-19)14-18-5-2-3-6-20(18)23/h2-3,5-6,8-11,13,15,21H,4,7,12,14H2,1H3 |
| InChIKey | LWLUKURRCLLZCT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |