C11H21N5O2S2 — CID 167925195
3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-propylpiperidine-1-sulfonamide (PubChem CID 167925195) has the molecular formula C11H21N5O2S2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-propylpiperidine-1-sulfonamide.
| Compound Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-propylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 167925195 |
| Molecular Formula | C11H21N5O2S2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-propylpiperidine-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CCCC(c2n[nH]c(=S)n2C)C1 |
| InChI | InChI=1S/C11H21N5O2S2/c1-3-6-12-20(17,18)16-7-4-5-9(8-16)10-13-14-11(19)15(10)2/h9,12H,3-8H2,1-2H3,(H,14,19) |
| InChIKey | WXCULXZARFWOJG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|