C17H25N5O4S — CID 91948340
8-(1-cyclopentylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 91948340) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is 8-(1-cyclopentylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-cyclopentylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 91948340 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 8-(1-cyclopentylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C3CCN(S(=O)(=O)C4CCCC4)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C17H25N5O4S/c1-20-15-13(16(23)21(2)17(20)24)18-14(19-15)11-7-9-22(10-8-11)27(25,26)12-5-3-4-6-12/h11-12H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | KMLBZQKEXYWHDX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |