C16H25N5O4S — CID 91948374
8-(1-butylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 91948374) has the molecular formula C16H25N5O4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 8-(1-butylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-butylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 91948374 |
| Molecular Formula | C16H25N5O4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 8-(1-butylsulfonylpiperidin-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CCCCS(=O)(=O)N1CCC(c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)CC1 |
| InChI | InChI=1S/C16H25N5O4S/c1-4-5-10-26(24,25)21-8-6-11(7-9-21)13-17-12-14(18-13)19(2)16(23)20(3)15(12)22/h11H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | YSTIEUKGWXAWSP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |