C13H11BrN4O3 — CID 136863765
8-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 136863765) has the molecular formula C13H11BrN4O3 and a molecular weight of 351.16 g/mol. Its IUPAC name is 8-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 136863765 |
| Molecular Formula | C13H11BrN4O3 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 8-(5-bromo-2-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cc(Br)ccc3O)nc2n(C)c1=O |
| InChI | InChI=1S/C13H11BrN4O3/c1-17-11-9(12(20)18(2)13(17)21)15-10(16-11)7-5-6(14)3-4-8(7)19/h3-5,19H,1-2H3,(H,15,16) |
| InChIKey | XXAAGJUWCJAAJG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |