C14H13N5O3 — CID 167483244
8-(5-acetyl-2-pyridinyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 167483244) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 8-(5-acetyl-2-pyridinyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(5-acetyl-2-pyridinyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 167483244 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 8-(5-acetyl-2-pyridinyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CC(=O)c1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)nc1 |
| InChI | InChI=1S/C14H13N5O3/c1-7(20)8-4-5-9(15-6-8)11-16-10-12(17-11)18(2)14(22)19(3)13(10)21/h4-6H,1-3H3,(H,16,17) |
| InChIKey | KLNSAHYPIKKNHW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |