C15H13N7O3 — CID 67959576
8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 67959576) has the molecular formula C15H13N7O3 and a molecular weight of 339.32 g/mol. Its IUPAC name is 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67959576 |
| Molecular Formula | C15H13N7O3 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cn(-c4ccc(O)cc4)nn3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H13N7O3/c1-20-13-11(14(24)21(2)15(20)25)16-12(17-13)10-7-22(19-18-10)8-3-5-9(23)6-4-8/h3-7,23H,1-2H3,(H,16,17) |
| InChIKey | MEIIMBVPFFDKHL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |