About 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione
8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 67959576) has the molecular formula C15H13N7O3
and a molecular weight of 339.32 g/mol. Its IUPAC name is 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 67959576 |
| Molecular Formula | C15H13N7O3 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cn(-c4ccc(O)cc4)nn3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H13N7O3/c1-20-13-11(14(24)21(2)15(20)25)16-12(17-13)10-7-22(19-18-10)8-3-5-9(23)6-4-8/h3-7,23H,1-2H3,(H,16,17) |
| InChIKey | MEIIMBVPFFDKHL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione (CID 67959576) is 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(-c3cn(-c4ccc(O)cc4)nn3)nc2n(C)c1=O.
What is the InChIKey of 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is MEIIMBVPFFDKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N7O3/c1-20-13-11(14(24)21(2)15(20)25)16-12(17-13)10-7-22(19-18-10)8-3-5-9(23)6-4-8/h3-7,23H,1-2H3,(H,16,17).
What are the key properties of 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 339.32 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1-(4-hydroxyphenyl)triazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 67959576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).