C15H16N4O5 — CID 139621134
8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 139621134) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 139621134 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1cc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc(OC)c1O |
| InChI | InChI=1S/C15H16N4O5/c1-18-13-10(14(21)19(2)15(18)22)16-12(17-13)7-5-8(23-3)11(20)9(6-7)24-4/h5-6,20H,1-4H3,(H,16,17) |
| InChIKey | KBCUPWHRAQYRJA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |