C27H32N4O4 — CID 135847573
8-(3,5-dibutyl-4-hydroxyphenyl)-3-(4-methoxyphenyl)-1-methyl-7H-purine-2,6-dione (PubChem CID 135847573) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 8-(3,5-dibutyl-4-hydroxyphenyl)-3-(4-methoxyphenyl)-1-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(3,5-dibutyl-4-hydroxyphenyl)-3-(4-methoxyphenyl)-1-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 135847573 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 8-(3,5-dibutyl-4-hydroxyphenyl)-3-(4-methoxyphenyl)-1-methyl-7H-purine-2,6-dione |
| SMILES | CCCCc1cc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3-c2ccc(OC)cc2)cc(CCCC)c1O |
| InChI | InChI=1S/C27H32N4O4/c1-5-7-9-17-15-19(16-18(23(17)32)10-8-6-2)24-28-22-25(29-24)31(27(34)30(3)26(22)33)20-11-13-21(35-4)14-12-20/h11-16,32H,5-10H2,1-4H3,(H,28,29) |
| InChIKey | SBJWSBSZCILWOS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |