C15H14N4O4S — CID 91174450
2-[4-(1,3-dimethyl-6-oxo-2-sulfanylidene-7H-purin-8-yl)phenoxy]acetic acid (PubChem CID 91174450) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is 2-[4-(1,3-dimethyl-6-oxo-2-sulfanylidene-7H-purin-8-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(1,3-dimethyl-6-oxo-2-sulfanylidene-7H-purin-8-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 91174450 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[4-(1,3-dimethyl-6-oxo-2-sulfanylidene-7H-purin-8-yl)phenoxy]acetic acid |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccc(OCC(=O)O)cc3)nc2n(C)c1=S |
| InChI | InChI=1S/C15H14N4O4S/c1-18-13-11(14(22)19(2)15(18)24)16-12(17-13)8-3-5-9(6-4-8)23-7-10(20)21/h3-6H,7H2,1-2H3,(H,16,17)(H,20,21) |
| InChIKey | ACMOGWYUOVISMV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|