C23H17N5O4 — CID 15136416
(E)-3-[4-[3-[(4-cyanophenyl)methyl]-1-methyl-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid (PubChem CID 15136416) has the molecular formula C23H17N5O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is (E)-3-[4-[3-[(4-cyanophenyl)methyl]-1-methyl-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-[(4-cyanophenyl)methyl]-1-methyl-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15136416 |
| Molecular Formula | C23H17N5O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (E)-3-[4-[3-[(4-cyanophenyl)methyl]-1-methyl-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccc(/C=C/C(=O)O)cc3)nc2n(Cc2ccc(C#N)cc2)c1=O |
| InChI | InChI=1S/C23H17N5O4/c1-27-22(31)19-21(28(23(27)32)13-16-4-2-15(12-24)3-5-16)26-20(25-19)17-9-6-14(7-10-17)8-11-18(29)30/h2-11H,13H2,1H3,(H,25,26)(H,29,30)/b11-8+ |
| InChIKey | SLOOBSUTBZHBFE-DHZHZOJOSA-N |
| XLogP | 2.11 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|