C28H33ClN4O3 — CID 90994102
3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoyl chloride (PubChem CID 90994102) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is 3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoyl chloride.
| Compound Name | 3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoyl chloride |
|---|---|
| PubChem CID | 90994102 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoyl chloride |
| SMILES | O=C(Cl)C=Cc1ccc(-c2nc3c([nH]2)c(=O)n(CC2CCCCC2)c(=O)n3CC2CCCCC2)cc1 |
| InChI | InChI=1S/C28H33ClN4O3/c29-23(34)16-13-19-11-14-22(15-12-19)25-30-24-26(31-25)32(17-20-7-3-1-4-8-20)28(36)33(27(24)35)18-21-9-5-2-6-10-21/h11-16,20-21H,1-10,17-18H2,(H,30,31) |
| InChIKey | QMVDURFAJOOWRR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|