C31H38N4O5 — CID 23501936
(E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7-(2-oxopropyl)purin-8-yl]phenyl]prop-2-enoic acid (PubChem CID 23501936) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7-(2-oxopropyl)purin-8-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7-(2-oxopropyl)purin-8-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23501936 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7-(2-oxopropyl)purin-8-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(=O)Cn1c(-c2ccc(/C=C/C(=O)O)cc2)nc2c1c(=O)n(CC1CCCCC1)c(=O)n2CC1CCCCC1 |
| InChI | InChI=1S/C31H38N4O5/c1-21(36)18-33-27-29(32-28(33)25-15-12-22(13-16-25)14-17-26(37)38)34(19-23-8-4-2-5-9-23)31(40)35(30(27)39)20-24-10-6-3-7-11-24/h12-17,23-24H,2-11,18-20H2,1H3,(H,37,38)/b17-14+ |
| InChIKey | QATZLAPOOLQBKB-SAPNQHFASA-N |
| XLogP | 4.87 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|