C31H36N6O3 — CID 22244981
1,3-bis(cyclohexylmethyl)-8-[3-[(E)-3-imidazol-1-yl-3-oxoprop-1-enyl]phenyl]-7H-purine-2,6-dione (PubChem CID 22244981) has the molecular formula C31H36N6O3 and a molecular weight of 540.67 g/mol. Its IUPAC name is 1,3-bis(cyclohexylmethyl)-8-[3-[(E)-3-imidazol-1-yl-3-oxoprop-1-enyl]phenyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-bis(cyclohexylmethyl)-8-[3-[(E)-3-imidazol-1-yl-3-oxoprop-1-enyl]phenyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 22244981 |
| Molecular Formula | C31H36N6O3 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 1,3-bis(cyclohexylmethyl)-8-[3-[(E)-3-imidazol-1-yl-3-oxoprop-1-enyl]phenyl]-7H-purine-2,6-dione |
| SMILES | O=C(/C=C/c1cccc(-c2nc3c([nH]2)c(=O)n(CC2CCCCC2)c(=O)n3CC2CCCCC2)c1)n1ccnc1 |
| InChI | InChI=1S/C31H36N6O3/c38-26(35-17-16-32-21-35)15-14-22-12-7-13-25(18-22)28-33-27-29(34-28)36(19-23-8-3-1-4-9-23)31(40)37(30(27)39)20-24-10-5-2-6-11-24/h7,12-18,21,23-24H,1-6,8-11,19-20H2,(H,33,34)/b15-14+ |
| InChIKey | SKUVJNKRXVFOBG-CCEZHUSRSA-N |
| XLogP | 5.26 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|