C47H65N5O9 — CID 10234562
(E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide (PubChem CID 10234562) has the molecular formula C47H65N5O9 and a molecular weight of 844.06 g/mol. Its IUPAC name is (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10234562 |
| Molecular Formula | C47H65N5O9 |
| Molecular Weight | 844.06 g/mol |
| Exact Mass | 843.48 |
| IUPAC Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2nc3c([nH]2)c(=O)n(CC2CCCCC2)c(=O)n3CC2CCCCC2)cc1)NCCOCCOCCOCCOCCOCCOCc1ccccc1 |
| InChI | InChI=1S/C47H65N5O9/c53-42(48-22-23-56-24-25-57-26-27-58-28-29-59-30-31-60-32-33-61-36-40-14-8-3-9-15-40)21-18-37-16-19-41(20-17-37)44-49-43-45(50-44)51(34-38-10-4-1-5-11-38)47(55)52(46(43)54)35-39-12-6-2-7-13-39/h3,8-9,14-21,38-39H,1-2,4-7,10-13,22-36H2,(H,48,53)(H,49,50)/b21-18+ |
| InChIKey | KEJILXPILOAWSU-DYTRJAOYSA-N |
| XLogP | 6.14 |
| TPSA | 157.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.06 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|