C30H39N5O4 — CID 141267941
(E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 141267941) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 141267941 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | (E)-3-[4-[1,3-bis(cyclohexylmethyl)-2,6-dioxo-7H-purin-8-yl]phenyl]-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2nc3c([nH]2)c(=O)n(CC2CCCCC2)c(=O)n3CC2CCCCC2)cc1)NCCO |
| InChI | InChI=1S/C30H39N5O4/c36-18-17-31-25(37)16-13-21-11-14-24(15-12-21)27-32-26-28(33-27)34(19-22-7-3-1-4-8-22)30(39)35(29(26)38)20-23-9-5-2-6-10-23/h11-16,22-23,36H,1-10,17-20H2,(H,31,37)(H,32,33)/b16-13+ |
| InChIKey | MNTNKRJYYGCTCR-DTQAZKPQSA-N |
| XLogP | 3.84 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|