C27H38ClN5O3 — CID 87932345
1,3-bis(cyclohexylmethyl)-8-[4-[(methoxyamino)methyl]phenyl]-7H-purine-2,6-dione;hydrochloride (PubChem CID 87932345) has the molecular formula C27H38ClN5O3 and a molecular weight of 516.09 g/mol. Its IUPAC name is 1,3-bis(cyclohexylmethyl)-8-[4-[(methoxyamino)methyl]phenyl]-7H-purine-2,6-dione;hydrochloride.
| Compound Name | 1,3-bis(cyclohexylmethyl)-8-[4-[(methoxyamino)methyl]phenyl]-7H-purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 87932345 |
| Molecular Formula | C27H38ClN5O3 |
| Molecular Weight | 516.09 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 1,3-bis(cyclohexylmethyl)-8-[4-[(methoxyamino)methyl]phenyl]-7H-purine-2,6-dione;hydrochloride |
| SMILES | CONCc1ccc(-c2nc3c([nH]2)c(=O)n(CC2CCCCC2)c(=O)n3CC2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C27H37N5O3.ClH/c1-35-28-16-19-12-14-22(15-13-19)24-29-23-25(30-24)31(17-20-8-4-2-5-9-20)27(34)32(26(23)33)18-21-10-6-3-7-11-21;/h12-15,20-21,28H,2-11,16-18H2,1H3,(H,29,30);1H |
| InChIKey | UMCIMBLRLMAWHA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.09 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|