C23H22FN5O2 — CID 69115150
8-[(3-aminophenyl)methyl]-3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione (PubChem CID 69115150) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is 8-[(3-aminophenyl)methyl]-3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione.
| Compound Name | 8-[(3-aminophenyl)methyl]-3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 69115150 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 8-[(3-aminophenyl)methyl]-3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione |
| SMILES | Nc1cccc(Cc2nc3c([nH]2)c(=O)n(Cc2ccccc2F)c(=O)n3CC2CC2)c1 |
| InChI | InChI=1S/C23H22FN5O2/c24-18-7-2-1-5-16(18)13-29-22(30)20-21(28(23(29)31)12-14-8-9-14)27-19(26-20)11-15-4-3-6-17(25)10-15/h1-7,10,14H,8-9,11-13,25H2,(H,26,27) |
| InChIKey | HTHIUKRWDCDHHL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|