C24H21FN5O4Rh- — CID 163437744
3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-8-[[4-[hydroxy(oxomethyl)amino]phenyl]methyl]-7H-purine-2,6-dione;rhodium (PubChem CID 163437744) has the molecular formula C24H21FN5O4Rh- and a molecular weight of 565.37 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-8-[[4-[hydroxy(oxomethyl)amino]phenyl]methyl]-7H-purine-2,6-dione;rhodium.
| Compound Name | 3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-8-[[4-[hydroxy(oxomethyl)amino]phenyl]methyl]-7H-purine-2,6-dione;rhodium |
|---|---|
| PubChem CID | 163437744 |
| Molecular Formula | C24H21FN5O4Rh- |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 3-(cyclopropylmethyl)-1-[(2-fluorophenyl)methyl]-8-[[4-[hydroxy(oxomethyl)amino]phenyl]methyl]-7H-purine-2,6-dione;rhodium |
| SMILES | O=[C-]N(O)c1ccc(Cc2nc3c([nH]2)c(=O)n(Cc2ccccc2F)c(=O)n3CC2CC2)cc1.[Rh] |
| InChI | InChI=1S/C24H21FN5O4.Rh/c25-19-4-2-1-3-17(19)13-29-23(32)21-22(28(24(29)33)12-16-5-6-16)27-20(26-21)11-15-7-9-18(10-8-15)30(34)14-31;/h1-4,7-10,16,34H,5-6,11-13H2,(H,26,27);/q-1; |
| InChIKey | FAKDSCHUBHKWPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|