C25H25F4N5O4 — CID 69115638
8-[(4-aminophenyl)methyl]-3-butyl-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 69115638) has the molecular formula C25H25F4N5O4 and a molecular weight of 535.50 g/mol. Its IUPAC name is 8-[(4-aminophenyl)methyl]-3-butyl-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 8-[(4-aminophenyl)methyl]-3-butyl-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69115638 |
| Molecular Formula | C25H25F4N5O4 |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 8-[(4-aminophenyl)methyl]-3-butyl-1-[(2-fluorophenyl)methyl]-7H-purine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CCCCn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]c(Cc3ccc(N)cc3)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24FN5O2.C2HF3O2/c1-2-3-12-28-21-20(26-19(27-21)13-15-8-10-17(25)11-9-15)22(30)29(23(28)31)14-16-6-4-5-7-18(16)24;3-2(4,5)1(6)7/h4-11H,2-3,12-14,25H2,1H3,(H,26,27);(H,6,7) |
| InChIKey | UXTMVOJQHBIRLE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|